About (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol
(5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol (PubChem CID 107124795) has the molecular formula C12H18ClNOS
and a molecular weight of 259.80 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol.
Molecular Properties
| Compound Name | (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol |
| PubChem CID | 107124795 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol |
| SMILES | CCC1CCC(C(O)c2ncc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H18ClNOS/c1-2-8-3-5-9(6-4-8)11(15)12-14-7-10(13)16-12/h7-9,11,15H,2-6H2,1H3 |
| InChIKey | KDGQXEXNQGKAKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol?
The IUPAC name of (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol (CID 107124795) is (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol.
What is the SMILES notation for (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol?
The canonical SMILES for (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol is CCC1CCC(C(O)c2ncc(Cl)s2)CC1.
What is the InChIKey of (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol?
The InChIKey is KDGQXEXNQGKAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClNOS/c1-2-8-3-5-9(6-4-8)11(15)12-14-7-10(13)16-12/h7-9,11,15H,2-6H2,1H3.
What are the key properties of (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol?
(5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol has a molecular weight of 259.80 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3-thiazol-2-yl)-(4-ethylcyclohexyl)methanol is sourced from PubChem (CID 107124795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).