C8H12ClNO3S2 — CID 107124810
1-(5-chloro-1,3-thiazol-2-yl)-4-methylsulfonylbutan-1-ol (PubChem CID 107124810) has the molecular formula C8H12ClNO3S2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-4-methylsulfonylbutan-1-ol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-4-methylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 107124810 |
| Molecular Formula | C8H12ClNO3S2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-4-methylsulfonylbutan-1-ol |
| SMILES | CS(=O)(=O)CCCC(O)c1ncc(Cl)s1 |
| InChI | InChI=1S/C8H12ClNO3S2/c1-15(12,13)4-2-3-6(11)8-10-5-7(9)14-8/h5-6,11H,2-4H2,1H3 |
| InChIKey | PSFABXCOUDXGTA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |