About (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol
(5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol (PubChem CID 107124813) has the molecular formula C8H6ClN3OS
and a molecular weight of 227.68 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol.
Molecular Properties
| Compound Name | (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol |
| PubChem CID | 107124813 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol |
| SMILES | OC(c1cncnc1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C8H6ClN3OS/c9-6-3-12-8(14-6)7(13)5-1-10-4-11-2-5/h1-4,7,13H |
| InChIKey | GJHRLVAUVQOKCK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol?
The IUPAC name of (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol (CID 107124813) is (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol.
What is the SMILES notation for (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol?
The canonical SMILES for (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol is OC(c1cncnc1)c1ncc(Cl)s1.
What is the InChIKey of (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol?
The InChIKey is GJHRLVAUVQOKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3OS/c9-6-3-12-8(14-6)7(13)5-1-10-4-11-2-5/h1-4,7,13H.
What are the key properties of (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol?
(5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol has a molecular weight of 227.68 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-1,3-thiazol-2-yl)-pyrimidin-5-ylmethanol is sourced from PubChem (CID 107124813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).