C5H4ClF2NOS — CID 107124825
1-(5-chloro-1,3-thiazol-2-yl)-2,2-difluoroethanol (PubChem CID 107124825) has the molecular formula C5H4ClF2NOS and a molecular weight of 199.61 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-2,2-difluoroethanol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 107124825 |
| Molecular Formula | C5H4ClF2NOS |
| Molecular Weight | 199.61 g/mol |
| Exact Mass | 198.97 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-2,2-difluoroethanol |
| SMILES | OC(c1ncc(Cl)s1)C(F)F |
| InChI | InChI=1S/C5H4ClF2NOS/c6-2-1-9-5(11-2)3(10)4(7)8/h1,3-4,10H |
| InChIKey | ICTPUGWZPMAYBO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.61 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |