C8H9ClF3NOS — CID 107124869
1-(5-chloro-1,3-thiazol-2-yl)-5,5,5-trifluoropentan-1-ol (PubChem CID 107124869) has the molecular formula C8H9ClF3NOS and a molecular weight of 259.68 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 107124869 |
| Molecular Formula | C8H9ClF3NOS |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-5,5,5-trifluoropentan-1-ol |
| SMILES | OC(CCCC(F)(F)F)c1ncc(Cl)s1 |
| InChI | InChI=1S/C8H9ClF3NOS/c9-6-4-13-7(15-6)5(14)2-1-3-8(10,11)12/h4-5,14H,1-3H2 |
| InChIKey | FETALXBRUKEATN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |