About 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane
3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane (PubChem CID 10712525) has the molecular formula C15H25BrO2Si
and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane.
Molecular Properties
| Compound Name | 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane |
| PubChem CID | 10712525 |
| Molecular Formula | C15H25BrO2Si |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane |
| SMILES | C=C(Br)CC1(CC#C[Si](C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C15H25BrO2Si/c1-13(16)10-15(8-7-9-19(4,5)6)11-17-14(2,3)18-12-15/h1,8,10-12H2,2-6H3 |
| InChIKey | MBBFUORNZQELDU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane?
The IUPAC name of 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane (CID 10712525) is 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane.
What is the SMILES notation for 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane?
The canonical SMILES for 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane is C=C(Br)CC1(CC#C[Si](C)(C)C)COC(C)(C)OC1.
What is the InChIKey of 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane?
The InChIKey is MBBFUORNZQELDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25BrO2Si/c1-13(16)10-15(8-7-9-19(4,5)6)11-17-14(2,3)18-12-15/h1,8,10-12H2,2-6H3.
What are the key properties of 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane?
3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane has a molecular weight of 345.35 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2-bromoprop-2-enyl)-2,2-dimethyl-1,3-dioxan-5-yl]prop-1-ynyl-trimethylsilane is sourced from PubChem (CID 10712525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).