C11H18ClN3S — CID 107125612
2-(5-chloro-1,3-thiazol-2-yl)-1-ethylazepan-3-amine (PubChem CID 107125612) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-1-ethylazepan-3-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-1-ethylazepan-3-amine |
|---|---|
| PubChem CID | 107125612 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-1-ethylazepan-3-amine |
| SMILES | CCN1CCCCC(N)C1c1ncc(Cl)s1 |
| InChI | InChI=1S/C11H18ClN3S/c1-2-15-6-4-3-5-8(13)10(15)11-14-7-9(12)16-11/h7-8,10H,2-6,13H2,1H3 |
| InChIKey | FTNSLCHMLVNFFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |