C21H30O2S — CID 10712627
(3E,6E)-3-ethoxy-2,2,8,8-tetramethyl-7-phenylsulfanylnona-3,6-dien-5-one (PubChem CID 10712627) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is (3E,6E)-3-ethoxy-2,2,8,8-tetramethyl-7-phenylsulfanylnona-3,6-dien-5-one.
| Compound Name | (3E,6E)-3-ethoxy-2,2,8,8-tetramethyl-7-phenylsulfanylnona-3,6-dien-5-one |
|---|---|
| PubChem CID | 10712627 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3E,6E)-3-ethoxy-2,2,8,8-tetramethyl-7-phenylsulfanylnona-3,6-dien-5-one |
| SMILES | CCO/C(=C/C(=O)/C=C(/Sc1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H30O2S/c1-8-23-18(20(2,3)4)14-16(22)15-19(21(5,6)7)24-17-12-10-9-11-13-17/h9-15H,8H2,1-7H3/b18-14+,19-15+ |
| InChIKey | HCJLTVMFYKGMAZ-JSAVKQRWSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|