C22H38N2O — CID 10712631
1-ethyl-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea (PubChem CID 10712631) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-ethyl-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea.
| Compound Name | 1-ethyl-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea |
|---|---|
| PubChem CID | 10712631 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 1-ethyl-3-[(4Z,7Z,10Z,13Z)-nonadeca-4,7,10,13-tetraenyl]urea |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCNC(=O)NCC |
| InChI | InChI=1S/C22H38N2O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22(25)23-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-21H2,1-2H3,(H2,23,24,25)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | XFTXDUUQZWTDSQ-GKFVBPDJSA-N |
| XLogP | 6.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|