C18H24N2O — CID 107127326
1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanone (PubChem CID 107127326) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 107127326 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl(1,2,3,4-tetrahydronaphthalen-2-yl)methanone |
| SMILES | O=C(C1CCc2ccccc2C1)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C18H24N2O/c21-18(20-11-16-6-3-9-19-17(16)12-20)15-8-7-13-4-1-2-5-14(13)10-15/h1-2,4-5,15-17,19H,3,6-12H2 |
| InChIKey | KHXAEOQOEHALGJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |