C21H32O4 — CID 10712743
(1S,5R,6S,10E,14R,15S,17R)-14-hydroxy-6,10,14-trimethylspiro[4,16-dioxatricyclo[13.2.1.05,17]octadec-10-ene-2,1'-cyclopropane]-3-one (PubChem CID 10712743) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1S,5R,6S,10E,14R,15S,17R)-14-hydroxy-6,10,14-trimethylspiro[4,16-dioxatricyclo[13.2.1.05,17]octadec-10-ene-2,1'-cyclopropane]-3-one.
| Compound Name | (1S,5R,6S,10E,14R,15S,17R)-14-hydroxy-6,10,14-trimethylspiro[4,16-dioxatricyclo[13.2.1.05,17]octadec-10-ene-2,1'-cyclopropane]-3-one |
|---|---|
| PubChem CID | 10712743 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1S,5R,6S,10E,14R,15S,17R)-14-hydroxy-6,10,14-trimethylspiro[4,16-dioxatricyclo[13.2.1.05,17]octadec-10-ene-2,1'-cyclopropane]-3-one |
| SMILES | C/C1=C\CC[C@@](C)(O)[C@@H]2C[C@@H]3[C@@H](O2)[C@H](OC(=O)C32CC2)[C@@H](C)CCC1 |
| InChI | InChI=1S/C21H32O4/c1-13-6-4-8-14(2)17-18-15(21(10-11-21)19(22)25-17)12-16(24-18)20(3,23)9-5-7-13/h7,14-18,23H,4-6,8-12H2,1-3H3/b13-7+/t14-,15+,16-,17+,18+,20+/m0/s1 |
| InChIKey | DBRJVMJVGWTERM-XIWIIQRKSA-N |
| XLogP | 3.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|