About methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate
methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate (PubChem CID 1071278) has the molecular formula C17H16FNO6S
and a molecular weight of 381.38 g/mol. Its IUPAC name is methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate.
Molecular Properties
| Compound Name | methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate |
| PubChem CID | 1071278 |
| Molecular Formula | C17H16FNO6S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate |
| SMILES | COC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H16FNO6S/c1-23-17(20)11-19(13-4-2-12(18)3-5-13)26(21,22)14-6-7-15-16(10-14)25-9-8-24-15/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | PDVZVOFQFVHQTQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate?
The IUPAC name of methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate (CID 1071278) is methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate.
What is the SMILES notation for methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate?
The canonical SMILES for methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate is COC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc2c(c1)OCCO2.
What is the InChIKey of methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate?
The InChIKey is PDVZVOFQFVHQTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO6S/c1-23-17(20)11-19(13-4-2-12(18)3-5-13)26(21,22)14-6-7-15-16(10-14)25-9-8-24-15/h2-7,10H,8-9,11H2,1H3.
What are the key properties of methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate?
methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate has a molecular weight of 381.38 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetate is sourced from PubChem (CID 1071278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).