C11H15FO2 — CID 107128649
1-(3-fluoro-4-methylphenyl)butane-1,2-diol (PubChem CID 107128649) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)butane-1,2-diol.
| Compound Name | 1-(3-fluoro-4-methylphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 107128649 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)butane-1,2-diol |
| SMILES | CCC(O)C(O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C11H15FO2/c1-3-10(13)11(14)8-5-4-7(2)9(12)6-8/h4-6,10-11,13-14H,3H2,1-2H3 |
| InChIKey | ISNYKOFYEYVHJH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |