C16H15ClN2O5 — CID 10712873
ethyl 7-(4-chlorobenzoyl)-6-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[1,2-a]imidazole-6-carboxylate (PubChem CID 10712873) has the molecular formula C16H15ClN2O5 and a molecular weight of 350.76 g/mol. Its IUPAC name is ethyl 7-(4-chlorobenzoyl)-6-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[1,2-a]imidazole-6-carboxylate.
| Compound Name | ethyl 7-(4-chlorobenzoyl)-6-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[1,2-a]imidazole-6-carboxylate |
|---|---|
| PubChem CID | 10712873 |
| Molecular Formula | C16H15ClN2O5 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | ethyl 7-(4-chlorobenzoyl)-6-hydroxy-5-oxo-2,3-dihydro-1H-pyrrolo[1,2-a]imidazole-6-carboxylate |
| SMILES | CCOC(=O)C1(O)C(=O)N2CCNC2=C1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O5/c1-2-24-15(22)16(23)11(13-18-7-8-19(13)14(16)21)12(20)9-3-5-10(17)6-4-9/h3-6,18,23H,2,7-8H2,1H3 |
| InChIKey | KNNKCOWORFWKOP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|