C16H18FNO2S — CID 107130126
1-(3-fluoro-4-methylphenyl)-N-methyl-1-(4-methylsulfonylphenyl)methanamine (PubChem CID 107130126) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-N-methyl-1-(4-methylsulfonylphenyl)methanamine.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-N-methyl-1-(4-methylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 107130126 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-N-methyl-1-(4-methylsulfonylphenyl)methanamine |
| SMILES | CNC(c1ccc(S(C)(=O)=O)cc1)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C16H18FNO2S/c1-11-4-5-13(10-15(11)17)16(18-2)12-6-8-14(9-7-12)21(3,19)20/h4-10,16,18H,1-3H3 |
| InChIKey | IEYPUVHGYAUYFL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |