C17H14FN5O3S — CID 1071306
methyl 4-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate (PubChem CID 1071306) has the molecular formula C17H14FN5O3S and a molecular weight of 387.40 g/mol. Its IUPAC name is methyl 4-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate.
| Compound Name | methyl 4-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 1071306 |
| Molecular Formula | C17H14FN5O3S |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl 4-[5-[2-(4-fluoroanilino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2nnnc2SCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H14FN5O3S/c1-26-16(25)11-2-8-14(9-3-11)23-17(20-21-22-23)27-10-15(24)19-13-6-4-12(18)5-7-13/h2-9H,10H2,1H3,(H,19,24) |
| InChIKey | ZOOPFABBUWNHIP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |