About N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine
N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine (PubChem CID 107132839) has the molecular formula C8H16F2N2S
and a molecular weight of 210.29 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine |
| PubChem CID | 107132839 |
| Molecular Formula | C8H16F2N2S |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine |
| SMILES | NCC(NCC(F)F)C1CCSC1 |
| InChI | InChI=1S/C8H16F2N2S/c9-8(10)4-12-7(3-11)6-1-2-13-5-6/h6-8,12H,1-5,11H2 |
| InChIKey | CLHDBBFNLNCBPO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine?
The IUPAC name of N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine (CID 107132839) is N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine?
The canonical SMILES for N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine is NCC(NCC(F)F)C1CCSC1.
What is the InChIKey of N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine?
The InChIKey is CLHDBBFNLNCBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2S/c9-8(10)4-12-7(3-11)6-1-2-13-5-6/h6-8,12H,1-5,11H2.
What are the key properties of N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine?
N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine has a molecular weight of 210.29 g/mol, XLogP of 0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-1-(thiolan-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 107132839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).