C12H24N2OS — CID 107132888
N-[2-(2-methylprop-2-enoxy)ethyl]-1-(thiolan-3-yl)ethane-1,2-diamine (PubChem CID 107132888) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-1-(thiolan-3-yl)ethane-1,2-diamine.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1-(thiolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107132888 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-1-(thiolan-3-yl)ethane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)C1CCSC1 |
| InChI | InChI=1S/C12H24N2OS/c1-10(2)8-15-5-4-14-12(7-13)11-3-6-16-9-11/h11-12,14H,1,3-9,13H2,2H3 |
| InChIKey | UFQIYURXDCDZIC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|