C10H20N2S — CID 107132892
N-(2-methylprop-2-enyl)-1-(thiolan-3-yl)ethane-1,2-diamine (PubChem CID 107132892) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-1-(thiolan-3-yl)ethane-1,2-diamine.
| Compound Name | N-(2-methylprop-2-enyl)-1-(thiolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107132892 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-(2-methylprop-2-enyl)-1-(thiolan-3-yl)ethane-1,2-diamine |
| SMILES | C=C(C)CNC(CN)C1CCSC1 |
| InChI | InChI=1S/C10H20N2S/c1-8(2)6-12-10(5-11)9-3-4-13-7-9/h9-10,12H,1,3-7,11H2,2H3 |
| InChIKey | WJDJYXVNSMYAGA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|