About 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane
3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 107133226) has the molecular formula C12H22N2S
and a molecular weight of 226.39 g/mol. Its IUPAC name is 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane.
Molecular Properties
| Compound Name | 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane |
| PubChem CID | 107133226 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | C1CC(CN2CCC3CCC(C2)N3)CS1 |
| InChI | InChI=1S/C12H22N2S/c1-2-12-8-14(5-3-11(1)13-12)7-10-4-6-15-9-10/h10-13H,1-9H2 |
| InChIKey | SHXUNTUVIQCHBC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane?
The IUPAC name of 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane (CID 107133226) is 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane.
What is the SMILES notation for 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane?
The canonical SMILES for 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane is C1CC(CN2CCC3CCC(C2)N3)CS1.
What is the InChIKey of 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane?
The InChIKey is SHXUNTUVIQCHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S/c1-2-12-8-14(5-3-11(1)13-12)7-10-4-6-15-9-10/h10-13H,1-9H2.
What are the key properties of 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane?
3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane has a molecular weight of 226.39 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiolan-3-ylmethyl)-3,9-diazabicyclo[4.2.1]nonane is sourced from PubChem (CID 107133226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).