About N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine
N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine (PubChem CID 107133230) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine.
Analyze N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine (CID 107133230) is N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine is CN(CCCN)CC1CCSC1.
What is the InChIKey of N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine?
The InChIKey is LRHFZJIFQVMKHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-11(5-2-4-10)7-9-3-6-12-8-9/h9H,2-8,10H2,1H3.
What are the key properties of N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine?
N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine has a molecular weight of 188.34 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(thiolan-3-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 107133230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).