C13H25NOS — CID 107133800
[1-(aminomethyl)-3-methylcyclohexyl]-(thiolan-3-yl)methanol (PubChem CID 107133800) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is [1-(aminomethyl)-3-methylcyclohexyl]-(thiolan-3-yl)methanol.
| Compound Name | [1-(aminomethyl)-3-methylcyclohexyl]-(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 107133800 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [1-(aminomethyl)-3-methylcyclohexyl]-(thiolan-3-yl)methanol |
| SMILES | CC1CCCC(CN)(C(O)C2CCSC2)C1 |
| InChI | InChI=1S/C13H25NOS/c1-10-3-2-5-13(7-10,9-14)12(15)11-4-6-16-8-11/h10-12,15H,2-9,14H2,1H3 |
| InChIKey | QDLKLNAOULEMIH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |