C11H21NS — CID 107133855
N,3-dimethyl-2-(thiolan-3-ylmethylidene)butan-1-amine (PubChem CID 107133855) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is N,3-dimethyl-2-(thiolan-3-ylmethylidene)butan-1-amine.
| Compound Name | N,3-dimethyl-2-(thiolan-3-ylmethylidene)butan-1-amine |
|---|---|
| PubChem CID | 107133855 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N,3-dimethyl-2-(thiolan-3-ylmethylidene)butan-1-amine |
| SMILES | CNCC(=CC1CCSC1)C(C)C |
| InChI | InChI=1S/C11H21NS/c1-9(2)11(7-12-3)6-10-4-5-13-8-10/h6,9-10,12H,4-5,7-8H2,1-3H3 |
| InChIKey | JEZUBNDAUQABHW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|