About N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine
N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine (PubChem CID 107134572) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine |
| PubChem CID | 107134572 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine |
| SMILES | NCCCN(c1ccccc1)C1CCCOC1 |
| InChI | InChI=1S/C14H22N2O/c15-9-5-10-16(13-6-2-1-3-7-13)14-8-4-11-17-12-14/h1-3,6-7,14H,4-5,8-12,15H2 |
| InChIKey | YCQMMDDANKVQGG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine?
The IUPAC name of N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine (CID 107134572) is N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine.
What is the SMILES notation for N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine?
The canonical SMILES for N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine is NCCCN(c1ccccc1)C1CCCOC1.
What is the InChIKey of N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine?
The InChIKey is YCQMMDDANKVQGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c15-9-5-10-16(13-6-2-1-3-7-13)14-8-4-11-17-12-14/h1-3,6-7,14H,4-5,8-12,15H2.
What are the key properties of N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine?
N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine has a molecular weight of 234.34 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(oxan-3-yl)-N'-phenylpropane-1,3-diamine is sourced from PubChem (CID 107134572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).