C16H16F3NO5 — CID 10713460
[(1R,4S)-4-(nitromethyl)cyclopent-2-en-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10713460) has the molecular formula C16H16F3NO5 and a molecular weight of 359.30 g/mol. Its IUPAC name is [(1R,4S)-4-(nitromethyl)cyclopent-2-en-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1R,4S)-4-(nitromethyl)cyclopent-2-en-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10713460 |
| Molecular Formula | C16H16F3NO5 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [(1R,4S)-4-(nitromethyl)cyclopent-2-en-1-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@H]1C=C[C@@H](C[N+](=O)[O-])C1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO5/c1-24-15(16(17,18)19,12-5-3-2-4-6-12)14(21)25-13-8-7-11(9-13)10-20(22)23/h2-8,11,13H,9-10H2,1H3/t11-,13+,15-/m1/s1 |
| InChIKey | PNDUXKKPIHXWAX-OSAQELSMSA-N |
| XLogP | 2.86 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|