C14H20O3 — CID 107135084
(1R)-1-[4-methyl-2-(oxan-3-yloxy)phenyl]ethanol (PubChem CID 107135084) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R)-1-[4-methyl-2-(oxan-3-yloxy)phenyl]ethanol.
| Compound Name | (1R)-1-[4-methyl-2-(oxan-3-yloxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107135084 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R)-1-[4-methyl-2-(oxan-3-yloxy)phenyl]ethanol |
| SMILES | Cc1ccc([C@@H](C)O)c(OC2CCCOC2)c1 |
| InChI | InChI=1S/C14H20O3/c1-10-5-6-13(11(2)15)14(8-10)17-12-4-3-7-16-9-12/h5-6,8,11-12,15H,3-4,7,9H2,1-2H3/t11-,12?/m1/s1 |
| InChIKey | KPNLSGDFPGPVLQ-JHJMLUEUSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |