About 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane
3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane (PubChem CID 107135152) has the molecular formula C12H13BrCl2O2
and a molecular weight of 340.04 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane.
Molecular Properties
| Compound Name | 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane |
| PubChem CID | 107135152 |
| Molecular Formula | C12H13BrCl2O2 |
| Molecular Weight | 340.04 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane |
| SMILES | Clc1cc(Cl)c(OC2CCCOC2)c(CBr)c1 |
| InChI | InChI=1S/C12H13BrCl2O2/c13-6-8-4-9(14)5-11(15)12(8)17-10-2-1-3-16-7-10/h4-5,10H,1-3,6-7H2 |
| InChIKey | WCAWGXACZRTYII-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.04 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane?
The IUPAC name of 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane (CID 107135152) is 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane.
What is the SMILES notation for 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane?
The canonical SMILES for 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane is Clc1cc(Cl)c(OC2CCCOC2)c(CBr)c1.
What is the InChIKey of 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane?
The InChIKey is WCAWGXACZRTYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrCl2O2/c13-6-8-4-9(14)5-11(15)12(8)17-10-2-1-3-16-7-10/h4-5,10H,1-3,6-7H2.
What are the key properties of 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane?
3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane has a molecular weight of 340.04 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(bromomethyl)-4,6-dichlorophenoxy]oxane is sourced from PubChem (CID 107135152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).