About 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide
4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide (PubChem CID 10713528) has the molecular formula C18H14F2N2O2S
and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide |
| PubChem CID | 10713528 |
| Molecular Formula | C18H14F2N2O2S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(N)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C18H14F2N2O2S/c1-11-2-3-13(10-22-11)16-9-18(20)17(19)8-15(16)12-4-6-14(7-5-12)25(21,23)24/h2-10H,1H3,(H2,21,23,24) |
| InChIKey | NVDWWXSVMQNLOI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide?
The IUPAC name of 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide (CID 10713528) is 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide?
The canonical SMILES for 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide is Cc1ccc(-c2cc(F)c(F)cc2-c2ccc(S(N)(=O)=O)cc2)cn1.
What is the InChIKey of 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide?
The InChIKey is NVDWWXSVMQNLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2O2S/c1-11-2-3-13(10-22-11)16-9-18(20)17(19)8-15(16)12-4-6-14(7-5-12)25(21,23)24/h2-10H,1H3,(H2,21,23,24).
What are the key properties of 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide?
4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide has a molecular weight of 360.39 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-difluoro-2-(6-methyl-3-pyridinyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 10713528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).