C14H18F2O4 — CID 107135528
[3-(difluoromethoxy)-4-methoxyphenyl]-(oxan-3-yl)methanol (PubChem CID 107135528) has the molecular formula C14H18F2O4 and a molecular weight of 288.29 g/mol. Its IUPAC name is [3-(difluoromethoxy)-4-methoxyphenyl]-(oxan-3-yl)methanol.
| Compound Name | [3-(difluoromethoxy)-4-methoxyphenyl]-(oxan-3-yl)methanol |
|---|---|
| PubChem CID | 107135528 |
| Molecular Formula | C14H18F2O4 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [3-(difluoromethoxy)-4-methoxyphenyl]-(oxan-3-yl)methanol |
| SMILES | COc1ccc(C(O)C2CCCOC2)cc1OC(F)F |
| InChI | InChI=1S/C14H18F2O4/c1-18-11-5-4-9(7-12(11)20-14(15)16)13(17)10-3-2-6-19-8-10/h4-5,7,10,13-14,17H,2-3,6,8H2,1H3 |
| InChIKey | REJYCSBCWFJOEO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |