C22H32O4 — CID 10713564
2'-(2,4-dimethyl-3-oxopentan-2-yl)-4',4',6',6'-tetramethylspiro[1,3-dioxolane-2,7'-1H-indene]-5'-one (PubChem CID 10713564) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2'-(2,4-dimethyl-3-oxopentan-2-yl)-4',4',6',6'-tetramethylspiro[1,3-dioxolane-2,7'-1H-indene]-5'-one.
| Compound Name | 2'-(2,4-dimethyl-3-oxopentan-2-yl)-4',4',6',6'-tetramethylspiro[1,3-dioxolane-2,7'-1H-indene]-5'-one |
|---|---|
| PubChem CID | 10713564 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2'-(2,4-dimethyl-3-oxopentan-2-yl)-4',4',6',6'-tetramethylspiro[1,3-dioxolane-2,7'-1H-indene]-5'-one |
| SMILES | CC(C)C(=O)C(C)(C)C1=CC2=C(C1)C1(OCCO1)C(C)(C)C(=O)C2(C)C |
| InChI | InChI=1S/C22H32O4/c1-13(2)17(23)19(3,4)14-11-15-16(12-14)22(25-9-10-26-22)21(7,8)18(24)20(15,5)6/h11,13H,9-10,12H2,1-8H3 |
| InChIKey | LTDCXPQXBNUFKS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |