C17H34N2O — CID 107136588
N,2-diethyl-1-(oxan-3-yl)-2-pyrrolidin-1-ylbutan-1-amine (PubChem CID 107136588) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is N,2-diethyl-1-(oxan-3-yl)-2-pyrrolidin-1-ylbutan-1-amine.
| Compound Name | N,2-diethyl-1-(oxan-3-yl)-2-pyrrolidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 107136588 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N,2-diethyl-1-(oxan-3-yl)-2-pyrrolidin-1-ylbutan-1-amine |
| SMILES | CCNC(C1CCCOC1)C(CC)(CC)N1CCCC1 |
| InChI | InChI=1S/C17H34N2O/c1-4-17(5-2,19-11-7-8-12-19)16(18-6-3)15-10-9-13-20-14-15/h15-16,18H,4-14H2,1-3H3 |
| InChIKey | KKGXSERIFSDQLA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |