C21H18N2O4 — CID 10713660
dimethyl 2-anilino-6-phenylpyridine-3,4-dicarboxylate (PubChem CID 10713660) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is dimethyl 2-anilino-6-phenylpyridine-3,4-dicarboxylate.
| Compound Name | dimethyl 2-anilino-6-phenylpyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10713660 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | dimethyl 2-anilino-6-phenylpyridine-3,4-dicarboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)nc(Nc2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C21H18N2O4/c1-26-20(24)16-13-17(14-9-5-3-6-10-14)23-19(18(16)21(25)27-2)22-15-11-7-4-8-12-15/h3-13H,1-2H3,(H,22,23) |
| InChIKey | JCWYESONBKJOIA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |