C12H17BrN2O — CID 107136699
1-(5-bromo-3-pyridinyl)-N-methyl-1-(oxan-3-yl)methanamine (PubChem CID 107136699) has the molecular formula C12H17BrN2O and a molecular weight of 285.19 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-N-methyl-1-(oxan-3-yl)methanamine.
| Compound Name | 1-(5-bromo-3-pyridinyl)-N-methyl-1-(oxan-3-yl)methanamine |
|---|---|
| PubChem CID | 107136699 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-N-methyl-1-(oxan-3-yl)methanamine |
| SMILES | CNC(c1cncc(Br)c1)C1CCCOC1 |
| InChI | InChI=1S/C12H17BrN2O/c1-14-12(9-3-2-4-16-8-9)10-5-11(13)7-15-6-10/h5-7,9,12,14H,2-4,8H2,1H3 |
| InChIKey | XMFZFVGERAQYKJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |