C20H26O4S — CID 10713694
(4S,5S,6E,8S,9E,14R)-5,8-dihydroxy-14-methyl-4-phenylsulfanyl-1-oxacyclotetradeca-6,9-dien-2-one (PubChem CID 10713694) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is (4S,5S,6E,8S,9E,14R)-5,8-dihydroxy-14-methyl-4-phenylsulfanyl-1-oxacyclotetradeca-6,9-dien-2-one.
| Compound Name | (4S,5S,6E,8S,9E,14R)-5,8-dihydroxy-14-methyl-4-phenylsulfanyl-1-oxacyclotetradeca-6,9-dien-2-one |
|---|---|
| PubChem CID | 10713694 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (4S,5S,6E,8S,9E,14R)-5,8-dihydroxy-14-methyl-4-phenylsulfanyl-1-oxacyclotetradeca-6,9-dien-2-one |
| SMILES | C[C@@H]1CCC/C=C/[C@H](O)/C=C/[C@H](O)[C@@H](Sc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C20H26O4S/c1-15-8-4-2-5-9-16(21)12-13-18(22)19(14-20(23)24-15)25-17-10-6-3-7-11-17/h3,5-7,9-13,15-16,18-19,21-22H,2,4,8,14H2,1H3/b9-5+,13-12+/t15-,16+,18+,19+/m1/s1 |
| InChIKey | YCWWLHTWIOOFOO-WXHATXFUSA-N |
| XLogP | 3.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|