C20H30O2SSi — CID 10713706
(1R,3S,4S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylbicyclo[2.2.2]octan-2-one (PubChem CID 10713706) has the molecular formula C20H30O2SSi and a molecular weight of 362.61 g/mol. Its IUPAC name is (1R,3S,4S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylbicyclo[2.2.2]octan-2-one.
| Compound Name | (1R,3S,4S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylbicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 10713706 |
| Molecular Formula | C20H30O2SSi |
| Molecular Weight | 362.61 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,3S,4S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylsulfanylbicyclo[2.2.2]octan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H]2CC[C@H]1C(=O)[C@H]2Sc1ccccc1 |
| InChI | InChI=1S/C20H30O2SSi/c1-20(2,3)24(4,5)22-17-13-14-11-12-16(17)18(21)19(14)23-15-9-7-6-8-10-15/h6-10,14,16-17,19H,11-13H2,1-5H3/t14-,16+,17-,19-/m0/s1 |
| InChIKey | CPHXHRUOSGFDCD-RUENVJTFSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|