C9H10Cl2N2O2 — CID 107137208
5,6-dichloro-3-(oxan-3-yl)pyrimidin-4-one (PubChem CID 107137208) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 5,6-dichloro-3-(oxan-3-yl)pyrimidin-4-one.
| Compound Name | 5,6-dichloro-3-(oxan-3-yl)pyrimidin-4-one |
|---|---|
| PubChem CID | 107137208 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 5,6-dichloro-3-(oxan-3-yl)pyrimidin-4-one |
| SMILES | O=c1c(Cl)c(Cl)ncn1C1CCCOC1 |
| InChI | InChI=1S/C9H10Cl2N2O2/c10-7-8(11)12-5-13(9(7)14)6-2-1-3-15-4-6/h5-6H,1-4H2 |
| InChIKey | JNGDEJUVYAOVQW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |