C18H19BrO3 — CID 10713728
(2S,3S,4S)-3-bromo-2,4-dimethoxy-2-(4-methylphenyl)-3,4-dihydrochromene (PubChem CID 10713728) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is (2S,3S,4S)-3-bromo-2,4-dimethoxy-2-(4-methylphenyl)-3,4-dihydrochromene.
| Compound Name | (2S,3S,4S)-3-bromo-2,4-dimethoxy-2-(4-methylphenyl)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 10713728 |
| Molecular Formula | C18H19BrO3 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (2S,3S,4S)-3-bromo-2,4-dimethoxy-2-(4-methylphenyl)-3,4-dihydrochromene |
| SMILES | CO[C@H]1c2ccccc2O[C@@](OC)(c2ccc(C)cc2)[C@H]1Br |
| InChI | InChI=1S/C18H19BrO3/c1-12-8-10-13(11-9-12)18(21-3)17(19)16(20-2)14-6-4-5-7-15(14)22-18/h4-11,16-17H,1-3H3/t16-,17-,18-/m0/s1 |
| InChIKey | RRIAPZDZMPPPOX-BZSNNMDCSA-N |
| XLogP | 4.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|