About 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane
1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane (PubChem CID 107137317) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane |
| PubChem CID | 107137317 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane |
| SMILES | Cc1cc(N2CCCNCC2)ccc1OC1CCCOC1 |
| InChI | InChI=1S/C17H26N2O2/c1-14-12-15(19-9-3-7-18-8-10-19)5-6-17(14)21-16-4-2-11-20-13-16/h5-6,12,16,18H,2-4,7-11,13H2,1H3 |
| InChIKey | QRWNPICYBJBIES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane?
The IUPAC name of 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane (CID 107137317) is 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane.
What is the SMILES notation for 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane?
The canonical SMILES for 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane is Cc1cc(N2CCCNCC2)ccc1OC1CCCOC1.
What is the InChIKey of 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane?
The InChIKey is QRWNPICYBJBIES-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-14-12-15(19-9-3-7-18-8-10-19)5-6-17(14)21-16-4-2-11-20-13-16/h5-6,12,16,18H,2-4,7-11,13H2,1H3.
What are the key properties of 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane?
1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane has a molecular weight of 290.41 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-methyl-4-(oxan-3-yloxy)phenyl]-1,4-diazepane is sourced from PubChem (CID 107137317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).