About 3-(oxan-3-yl)pentan-2-ol
3-(oxan-3-yl)pentan-2-ol (PubChem CID 107137335) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-(oxan-3-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 3-(oxan-3-yl)pentan-2-ol |
| PubChem CID | 107137335 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-(oxan-3-yl)pentan-2-ol |
| SMILES | CCC(C(C)O)C1CCCOC1 |
| InChI | InChI=1S/C10H20O2/c1-3-10(8(2)11)9-5-4-6-12-7-9/h8-11H,3-7H2,1-2H3 |
| InChIKey | CDBXFPVWCVDELT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(oxan-3-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-3-yl)pentan-2-ol?
The IUPAC name of 3-(oxan-3-yl)pentan-2-ol (CID 107137335) is 3-(oxan-3-yl)pentan-2-ol.
What is the SMILES notation for 3-(oxan-3-yl)pentan-2-ol?
The canonical SMILES for 3-(oxan-3-yl)pentan-2-ol is CCC(C(C)O)C1CCCOC1.
What is the InChIKey of 3-(oxan-3-yl)pentan-2-ol?
The InChIKey is CDBXFPVWCVDELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-3-10(8(2)11)9-5-4-6-12-7-9/h8-11H,3-7H2,1-2H3.
What are the key properties of 3-(oxan-3-yl)pentan-2-ol?
3-(oxan-3-yl)pentan-2-ol has a molecular weight of 172.27 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-3-yl)pentan-2-ol is sourced from PubChem (CID 107137335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).