C14H22N4O5 — CID 107137423
5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1-(oxan-3-yl)triazole-4-carboxylic acid (PubChem CID 107137423) has the molecular formula C14H22N4O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1-(oxan-3-yl)triazole-4-carboxylic acid.
| Compound Name | 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1-(oxan-3-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107137423 |
| Molecular Formula | C14H22N4O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1-(oxan-3-yl)triazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCc1c(C(=O)O)nnn1C1CCCOC1 |
| InChI | InChI=1S/C14H22N4O5/c1-14(2,3)23-13(21)15-7-10-11(12(19)20)16-17-18(10)9-5-4-6-22-8-9/h9H,4-8H2,1-3H3,(H,15,21)(H,19,20) |
| InChIKey | QHETWAIQRMBAPD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |