About 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine
2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine (PubChem CID 107138253) has the molecular formula C11H22FNO
and a molecular weight of 203.30 g/mol. Its IUPAC name is 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine.
Molecular Properties
| Compound Name | 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine |
| PubChem CID | 107138253 |
| Molecular Formula | C11H22FNO |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine |
| SMILES | CC(C)(C)C(F)(CN)C1CCCOC1 |
| InChI | InChI=1S/C11H22FNO/c1-10(2,3)11(12,8-13)9-5-4-6-14-7-9/h9H,4-8,13H2,1-3H3 |
| InChIKey | CXRWODXRVNXKIP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine?
The IUPAC name of 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine (CID 107138253) is 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine.
What is the SMILES notation for 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine?
The canonical SMILES for 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine is CC(C)(C)C(F)(CN)C1CCCOC1.
What is the InChIKey of 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine?
The InChIKey is CXRWODXRVNXKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22FNO/c1-10(2,3)11(12,8-13)9-5-4-6-14-7-9/h9H,4-8,13H2,1-3H3.
What are the key properties of 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine?
2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine has a molecular weight of 203.30 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,3-dimethyl-2-(oxan-3-yl)butan-1-amine is sourced from PubChem (CID 107138253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).