C11H23NO3S — CID 107138962
N,2-dimethyl-2-methylsulfonyl-1-(oxan-3-yl)propan-1-amine (PubChem CID 107138962) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is N,2-dimethyl-2-methylsulfonyl-1-(oxan-3-yl)propan-1-amine.
| Compound Name | N,2-dimethyl-2-methylsulfonyl-1-(oxan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 107138962 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N,2-dimethyl-2-methylsulfonyl-1-(oxan-3-yl)propan-1-amine |
| SMILES | CNC(C1CCCOC1)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H23NO3S/c1-11(2,16(4,13)14)10(12-3)9-6-5-7-15-8-9/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | OUOPBYZIVSRJSG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |