C24H31NO2 — CID 10713898
(3S,4R,6S)-2-benzhydryl-6-tert-butyl-4-methyl-1-oxa-2-azaspiro[2.5]octan-4-ol (PubChem CID 10713898) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (3S,4R,6S)-2-benzhydryl-6-tert-butyl-4-methyl-1-oxa-2-azaspiro[2.5]octan-4-ol.
| Compound Name | (3S,4R,6S)-2-benzhydryl-6-tert-butyl-4-methyl-1-oxa-2-azaspiro[2.5]octan-4-ol |
|---|---|
| PubChem CID | 10713898 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (3S,4R,6S)-2-benzhydryl-6-tert-butyl-4-methyl-1-oxa-2-azaspiro[2.5]octan-4-ol |
| SMILES | CC(C)(C)[C@H]1CC[C@]2(ON2C(c2ccccc2)c2ccccc2)[C@](C)(O)C1 |
| InChI | InChI=1S/C24H31NO2/c1-22(2,3)20-15-16-24(23(4,26)17-20)25(27-24)21(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21,26H,15-17H2,1-4H3/t20-,23+,24-,25?/m0/s1 |
| InChIKey | ZFQCTPVURUCZGM-ILJKEPSESA-N |
| XLogP | 5.32 |
| TPSA | 35.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|