C20H34N2O4 — CID 10713956
2-[(R)-[(4S,5S)-4,5-bis(propan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine (PubChem CID 10713956) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[(R)-[(4S,5S)-4,5-bis(propan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(R)-[(4S,5S)-4,5-bis(propan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 10713956 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-[(R)-[(4S,5S)-4,5-bis(propan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine |
| SMILES | CC(C)OC[C@@H]1OC([C@H](NN(C)C)c2ccccc2)O[C@H]1COC(C)C |
| InChI | InChI=1S/C20H34N2O4/c1-14(2)23-12-17-18(13-24-15(3)4)26-20(25-17)19(21-22(5)6)16-10-8-7-9-11-16/h7-11,14-15,17-21H,12-13H2,1-6H3/t17-,18-,19+/m0/s1 |
| InChIKey | YJDZEUFLHVYZJT-GBESFXJTSA-N |
| XLogP | 2.75 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|