C14H17N5O3S2 — CID 10714009
(2S)-3-(4-methoxyphenyl)-N-methyl-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanamide (PubChem CID 10714009) has the molecular formula C14H17N5O3S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is (2S)-3-(4-methoxyphenyl)-N-methyl-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanamide.
| Compound Name | (2S)-3-(4-methoxyphenyl)-N-methyl-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 10714009 |
| Molecular Formula | C14H17N5O3S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (2S)-3-(4-methoxyphenyl)-N-methyl-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C14H17N5O3S2/c1-15-11(20)10(7-8-3-5-9(22-2)6-4-8)16-12(21)17-13-18-19-14(23)24-13/h3-6,10H,7H2,1-2H3,(H,15,20)(H,19,23)(H2,16,17,18,21)/t10-/m0/s1 |
| InChIKey | WBEQGNQOCQGJAT-JTQLQIEISA-N |
| XLogP | 1.69 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|