About 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol
5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol (PubChem CID 107140447) has the molecular formula C10H8Br2F2O
and a molecular weight of 341.98 g/mol. Its IUPAC name is 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol |
| PubChem CID | 107140447 |
| Molecular Formula | C10H8Br2F2O |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol |
| SMILES | OC1(C(F)(F)Br)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H8Br2F2O/c11-7-1-2-8-6(5-7)3-4-9(8,15)10(12,13)14/h1-2,5,15H,3-4H2 |
| InChIKey | CCTFMAYQMBHGCK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol?
The IUPAC name of 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol (CID 107140447) is 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol.
What is the SMILES notation for 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol?
The canonical SMILES for 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol is OC1(C(F)(F)Br)CCc2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol?
The InChIKey is CCTFMAYQMBHGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br2F2O/c11-7-1-2-8-6(5-7)3-4-9(8,15)10(12,13)14/h1-2,5,15H,3-4H2.
What are the key properties of 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol?
5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol has a molecular weight of 341.98 g/mol, XLogP of 3.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol is sourced from PubChem (CID 107140447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).