C10H8Br2F2O — CID 107140447
5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol (PubChem CID 107140447) has the molecular formula C10H8Br2F2O and a molecular weight of 341.98 g/mol. Its IUPAC name is 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol.
| Compound Name | 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 107140447 |
| Molecular Formula | C10H8Br2F2O |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 5-bromo-1-[bromo(difluoro)methyl]-2,3-dihydroinden-1-ol |
| SMILES | OC1(C(F)(F)Br)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H8Br2F2O/c11-7-1-2-8-6(5-7)3-4-9(8,15)10(12,13)14/h1-2,5,15H,3-4H2 |
| InChIKey | CCTFMAYQMBHGCK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|