About 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide
2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide (PubChem CID 10714135) has the molecular formula C12H14F3N3O3S2
and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide.
Molecular Properties
| Compound Name | 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide |
| PubChem CID | 10714135 |
| Molecular Formula | C12H14F3N3O3S2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide |
| SMILES | [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H14F3N3O3S2/c1-17(2)23(19,20)6-5-18-9-4-3-8(21-12(13,14)15)7-10(9)22-11(18)16/h3-4,7,16H,5-6H2,1-2H3/b16-11- |
| InChIKey | MFBFTVGGZIIWAV-WJDWOHSUSA-N |
| XLogP | 1.97 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide?
The IUPAC name of 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide (CID 10714135) is 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide.
What is the SMILES notation for 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide?
The canonical SMILES for 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide is [H]/N=c1\sc2cc(OC(F)(F)F)ccc2n1CCS(=O)(=O)N(C)C.
What is the InChIKey of 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide?
The InChIKey is MFBFTVGGZIIWAV-WJDWOHSUSA-N. The full InChI is InChI=1S/C12H14F3N3O3S2/c1-17(2)23(19,20)6-5-18-9-4-3-8(21-12(13,14)15)7-10(9)22-11(18)16/h3-4,7,16H,5-6H2,1-2H3/b16-11-.
What are the key properties of 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide?
2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide has a molecular weight of 369.39 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-imino-6-(trifluoromethoxy)-1,3-benzothiazol-3-yl]-N,N-dimethylethanesulfonamide is sourced from PubChem (CID 10714135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).