C15H24N2O5 — CID 107141592
2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(4-oxopiperidin-1-yl)azetidin-3-yl]acetic acid (PubChem CID 107141592) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(4-oxopiperidin-1-yl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(4-oxopiperidin-1-yl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107141592 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3-(4-oxopiperidin-1-yl)azetidin-3-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(=O)O)(N2CCC(=O)CC2)C1 |
| InChI | InChI=1S/C15H24N2O5/c1-14(2,3)22-13(21)16-9-15(10-16,8-12(19)20)17-6-4-11(18)5-7-17/h4-10H2,1-3H3,(H,19,20) |
| InChIKey | KAUPCZBTJGGWOG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |