C19H18N2O3S2 — CID 1071417
N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 1071417) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1071417 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cccs3)cc2)c(C)c1 |
| InChI | InChI=1S/C19H18N2O3S2/c1-13-5-10-17(14(2)12-13)21-26(23,24)16-8-6-15(7-9-16)20-19(22)18-4-3-11-25-18/h3-12,21H,1-2H3,(H,20,22) |
| InChIKey | QVSDFGWHLROQFG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |