About 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid
2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid (PubChem CID 107142145) has the molecular formula C14H15N3O4
and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid |
| PubChem CID | 107142145 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid |
| SMILES | CN1C(=O)c2ccc(NC3(CC(=O)O)CNC3)cc2C1=O |
| InChI | InChI=1S/C14H15N3O4/c1-17-12(20)9-3-2-8(4-10(9)13(17)21)16-14(5-11(18)19)6-15-7-14/h2-4,15-16H,5-7H2,1H3,(H,18,19) |
| InChIKey | SHYGCVQLMUEPBS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid?
The IUPAC name of 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid (CID 107142145) is 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid.
What is the SMILES notation for 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid?
The canonical SMILES for 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid is CN1C(=O)c2ccc(NC3(CC(=O)O)CNC3)cc2C1=O.
What is the InChIKey of 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid?
The InChIKey is SHYGCVQLMUEPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O4/c1-17-12(20)9-3-2-8(4-10(9)13(17)21)16-14(5-11(18)19)6-15-7-14/h2-4,15-16H,5-7H2,1H3,(H,18,19).
What are the key properties of 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid?
2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid has a molecular weight of 289.29 g/mol, XLogP of 0.14, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(2-methyl-1,3-dioxoisoindol-5-yl)amino]azetidin-3-yl]acetic acid is sourced from PubChem (CID 107142145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).